|
CAS#: 49828-75-3 Product: 1-Chloro-4-(4-Nitrophenoxy)-2-Propylsulfinyl-Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-(4-Nitrophenoxy)-2-Propylsulfinyl-Benzene |
|---|---|
| Synonyms | 1-Chloro-4-(4-Nitrophenoxy)-2-Propylsulfinyl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.79 |
| CAS Registry Number | 49828-75-3 |
| SMILES | C2=C(OC1=CC=C([N+]([O-])=O)C=C1)C=CC(=C2[S](=O)CCC)Cl |
| InChI | 1S/C15H14ClNO4S/c1-2-9-22(20)15-10-13(7-8-14(15)16)21-12-5-3-11(4-6-12)17(18)19/h3-8,10H,2,9H2,1H3 |
| InChIKey | SVZDUAFLNFAGIA-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.756°C at 760 mmHg (Cal.) |
| Flash point | 256.648°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-(4-Nitrophenoxy)-2-Propylsulfinyl-Benzene |