|
CAS#: 49852-84-8 Product: 6-(Chloromethyl)Benzo[b]Pyrene No suppilers available for the product. |
| Name | 6-(Chloromethyl)Benzo[b]Pyrene |
|---|---|
| Synonyms | 6-(Chloromethyl)Benzo(A)Pyrene; 6-Chloromethylbenzo(A)Pyrene; Benzo(A)Pyrene, 6-Chloromethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H13Cl |
| Molecular Weight | 300.79 |
| CAS Registry Number | 49852-84-8 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=CC=C4)CCl)C=CC=C5 |
| InChI | 1S/C21H13Cl/c22-12-19-16-7-2-1-6-15(16)17-10-8-13-4-3-5-14-9-11-18(19)21(17)20(13)14/h1-11H,12H2 |
| InChIKey | FRHNMMRZSKOSOL-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.879°C at 760 mmHg (Cal.) |
| Flash point | 243.569°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Chloromethyl)Benzo[b]Pyrene |