|
CAS#: 5010-35-5 Product: 5-Methyl-5-Phenylhexan-3-Ol No suppilers available for the product. |
| Name | 5-Methyl-5-Phenylhexan-3-Ol |
|---|---|
| Synonyms | 5-Methyl-5-Phenyl-Hexan-3-Ol; 3-Hexanol, 5-Methyl-5-Phenyl-; Benzenepropanol, Alpha-Ethyl-Gamma,Gamma-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 5010-35-5 |
| EINECS | 225-689-7 |
| SMILES | C1=CC=C(C=C1)C(C)(C)CC(O)CC |
| InChI | 1S/C13H20O/c1-4-12(14)10-13(2,3)11-8-6-5-7-9-11/h5-9,12,14H,4,10H2,1-3H3 |
| InChIKey | MIYLVQHVMLKMCN-UHFFFAOYSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.062°C at 760 mmHg (Cal.) |
| Flash point | 110.809°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-5-Phenylhexan-3-Ol |