|
CAS#: 5012-65-7 Product: beta-Rhodomycinone No suppilers available for the product. |
| Name | beta-Rhodomycinone |
|---|---|
| Synonyms | (7S,9R,10R)-9-Ethyl-4,6,7,9,10,11-Hexahydroxy-8,10-Dihydro-7H-Tetracene-5,12-Quinone; Beta-Rhodomycinone; 5,12-Naphthacenedione, 8-Ethyl-7,8,9,10-Tetrahydro-1,6,7,8,10,11-Hexahydroxy-, (7R-(7Alpha,8Beta,10Beta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 |
| CAS Registry Number | 5012-65-7 |
| SMILES | [C@H]4(C3=C(C2=C(C(C1=C(C(=CC=C1)O)C2=O)=O)C(=C3[C@H]([C@@](C4)(O)CC)O)O)O)O |
| InChI | 1S/C20H18O8/c1-2-20(28)6-9(22)11-14(19(20)27)18(26)12-13(17(11)25)16(24)10-7(15(12)23)4-3-5-8(10)21/h3-5,9,19,21-22,25-28H,2,6H2,1H3/t9-,19+,20+/m0/s1 |
| InChIKey | XGUMQVUWZOLAQN-RNFJLKLCSA-N |
| Density | 1.693g/cm3 (Cal.) |
|---|---|
| Boiling point | 576.965°C at 760 mmHg (Cal.) |
| Flash point | 316.781°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Rhodomycinone |