|
CAS#: 5025-37-6 Product: 9-Ethyl-3,6-Dimethoxy-10-Methylphenanthrene No suppilers available for the product. |
| Name | 9-Ethyl-3,6-Dimethoxy-10-Methylphenanthrene |
|---|---|
| Synonyms | 9-Ethyl-3,6-dimethoxy-10-methylphenanthrene # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.36 |
| CAS Registry Number | 5025-37-6 |
| SMILES | O(c3ccc2c(c(c1ccc(OC)cc1c2c3)CC)C)C |
| InChI | 1S/C19H20O2/c1-5-15-12(2)16-8-6-13(20-3)10-18(16)19-11-14(21-4)7-9-17(15)19/h6-11H,5H2,1-4H3 |
| InChIKey | WVJAQDCWIMWLQJ-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.36°C at 760 mmHg (Cal.) |
| Flash point | 180.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Ethyl-3,6-Dimethoxy-10-Methylphenanthrene |