|
CAS#: 5031-83-4 Product: 2,4-Diphenylcrotonaldehyde No suppilers available for the product. |
| Name | 2,4-Diphenylcrotonaldehyde |
|---|---|
| Synonyms | 2,4-Diphenylcrotonaldehyde; Benzeneacetaldehyde, Alpha-(2-Phenylethylidene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 |
| CAS Registry Number | 5031-83-4 |
| EINECS | 225-723-0 |
| SMILES | C2=C(\C(=C/CC1=CC=CC=C1)C=O)C=CC=C2 |
| InChI | 1S/C16H14O/c17-13-16(15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-10,12-13H,11H2/b16-12- |
| InChIKey | AXZDPAXJQHIRTE-VBKFSLOCSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.782°C at 760 mmHg (Cal.) |
| Flash point | 154.771°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diphenylcrotonaldehyde |