|
CAS#: 50332-15-5 Product: 5,6,7,8-Tetrahydro-5-Benzoylcyclopenta[b]-1,3-Dioxolo[4,5-f]Indole No suppilers available for the product. |
| Name | 5,6,7,8-Tetrahydro-5-Benzoylcyclopenta[b]-1,3-Dioxolo[4,5-f]Indole |
|---|---|
| Synonyms | Brn 1025795; Cyclopenta(B)-1,3-Dioxolo(4,5-F)Indole, 5,6,7,8-Tetrahydro-5-Benzoyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 |
| CAS Registry Number | 50332-15-5 |
| SMILES | C1=C5C(=CC2=C1C4=C([N]2C(C3=CC=CC=C3)=O)CCC4)OCO5 |
| InChI | 1S/C19H15NO3/c21-19(12-5-2-1-3-6-12)20-15-8-4-7-13(15)14-9-17-18(10-16(14)20)23-11-22-17/h1-3,5-6,9-10H,4,7-8,11H2 |
| InChIKey | PZNXHIBBQZXOPG-UHFFFAOYSA-N |
| Density | 1.408g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.482°C at 760 mmHg (Cal.) |
| Flash point | 206.286°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8-Tetrahydro-5-Benzoylcyclopenta[b]-1,3-Dioxolo[4,5-f]Indole |