|
CAS#: 50332-34-8 Product: 5,6,7,8,9,10-Hexahydro-5-(3-Bromobenzoyl)Cyclohepta[b]-1,3-Dioxolo[4,5-f]Indole No suppilers available for the product. |
| Name | 5,6,7,8,9,10-Hexahydro-5-(3-Bromobenzoyl)Cyclohepta[b]-1,3-Dioxolo[4,5-f]Indole |
|---|---|
| Synonyms | Cyclohepta(B)-1,3-Dioxolo(4,5-F)Indole, 5,6,7,8,9,10-Hexahydro-5-(M-Bromobenzoyl)-; 5-(3-Bromobenzoyl)-5,6,7,8,9,10-Hexahydrocyclohepta(B)-1,3-Dioxolo(4,5-F)Indole; Brn 1038240 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 |
| CAS Registry Number | 50332-34-8 |
| SMILES | C2=C1C4=C([NH]C1=CC3=C2OCO3)CCCCC4C(=O)C5=CC=CC(=C5)Br |
| InChI | 1S/C21H18BrNO3/c22-13-5-3-4-12(8-13)21(24)14-6-1-2-7-16-20(14)15-9-18-19(26-11-25-18)10-17(15)23-16/h3-5,8-10,14,23H,1-2,6-7,11H2 |
| InChIKey | AVRJJEHVUYNMGI-UHFFFAOYSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.296°C at 760 mmHg (Cal.) |
| Flash point | 312.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8,9,10-Hexahydro-5-(3-Bromobenzoyl)Cyclohepta[b]-1,3-Dioxolo[4,5-f]Indole |