|
CAS#: 50464-96-5 Product: 6,6-Dimethylundecane-2,5,10-Trione No suppilers available for the product. |
| Name | 6,6-Dimethylundecane-2,5,10-Trione |
|---|---|
| Synonyms | 2,5,10-Undecanetrione, 6,6-Dimethyl-; 6,6-Dimethyl-2,5,10-Undecanetrione |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 50464-96-5 |
| SMILES | C(C(=O)C)CC(=O)C(C)(C)CCCC(=O)C |
| InChI | 1S/C13H22O3/c1-10(14)6-5-9-13(3,4)12(16)8-7-11(2)15/h5-9H2,1-4H3 |
| InChIKey | ZASZETBXFSDFOD-UHFFFAOYSA-N |
| Density | 0.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.759°C at 760 mmHg (Cal.) |
| Flash point | 155.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6-Dimethylundecane-2,5,10-Trione |