|
CAS#: 50585-39-2 Product: 1,3-Dichlorodibenzo-Para-Dioxin No suppilers available for the product. |
| Name | 1,3-Dichlorodibenzo-Para-Dioxin |
|---|---|
| Synonyms | Brn 1315209; Dibenzo(B,E)(1,4)Dioxin, 1,3-Dichloro-; Dibenzo-P-Dioxin, 1,3-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl2O2 |
| Molecular Weight | 253.08 |
| CAS Registry Number | 50585-39-2 |
| SMILES | C1=C(Cl)C2=C(C=C1Cl)OC3=C(O2)C=CC=C3 |
| InChI | 1S/C12H6Cl2O2/c13-7-5-8(14)12-11(6-7)15-9-3-1-2-4-10(9)16-12/h1-6H |
| InChIKey | AZYJYMAKTBXNSX-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.85°C at 760 mmHg (Cal.) |
| Flash point | 139.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichlorodibenzo-Para-Dioxin |