|
CAS#: 50609-20-6 Product: 8-Tert-Butyladenine No suppilers available for the product. |
| Name | 8-Tert-Butyladenine |
|---|---|
| Synonyms | (8-Tert-Butyl-7H-Purin-6-Yl)Amine; 8-T-Butyladenine; 8-Tert-Butyladenine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 |
| CAS Registry Number | 50609-20-6 |
| SMILES | C2=NC1=C([NH]C(=N1)C(C)(C)C)C(=N2)N |
| InChI | 1S/C9H13N5/c1-9(2,3)8-13-5-6(10)11-4-12-7(5)14-8/h4H,1-3H3,(H3,10,11,12,13,14) |
| InChIKey | LSOOEJSTVYZUEI-UHFFFAOYSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.294°C at 760 mmHg (Cal.) |
| Flash point | 252.833°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Tert-Butyladenine |