|
CAS#: 50678-52-9 Product: 16-alpha-Chloro-20-Oxopregn-5-En-3-beta-Yl Acetate No suppilers available for the product. |
| Name | 16-alpha-Chloro-20-Oxopregn-5-En-3-beta-Yl Acetate |
|---|---|
| Synonyms | Acetic Acid [(3S,10R,13S,16R,17S)-17-Acetyl-16-Chloro-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Ester; [(3S,10R,13S,16R,17S)-16-Chloro-17-Ethanoyl-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H33ClO3 |
| Molecular Weight | 392.96 |
| CAS Registry Number | 50678-52-9 |
| EINECS | 256-708-7 |
| SMILES | [C@]34(C(C1C([C@@]2(C(=CC1)C[C@@H](OC(=O)C)CC2)C)CC3)C[C@@H](Cl)[C@@H]4C(=O)C)C |
| InChI | 1S/C23H33ClO3/c1-13(25)21-20(24)12-19-17-6-5-15-11-16(27-14(2)26)7-9-22(15,3)18(17)8-10-23(19,21)4/h5,16-21H,6-12H2,1-4H3/t16-,17?,18?,19?,20+,21-,22-,23-/m0/s1 |
| InChIKey | VEIABLNKNSOQQY-XAVZRLFQSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.054°C at 760 mmHg (Cal.) |
| Flash point | 158.823°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 16-alpha-Chloro-20-Oxopregn-5-En-3-beta-Yl Acetate |