|
CAS#: 50694-81-0 Product: 3,5-Dichloro-2,4-Toluenediamine No suppilers available for the product. |
| Name | 3,5-Dichloro-2,4-Toluenediamine |
|---|---|
| Synonyms | 2,4-Dichloro-6-Methyl-Benzene-1,3-Diamine; (3-Amino-2,4-Dichloro-6-Methyl-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8Cl2N2 |
| Molecular Weight | 191.06 |
| CAS Registry Number | 50694-81-0 |
| SMILES | C1=C(C(=C(Cl)C(=C1C)N)N)Cl |
| InChI | 1S/C7H8Cl2N2/c1-3-2-4(8)7(11)5(9)6(3)10/h2H,10-11H2,1H3 |
| InChIKey | MGLBJEAIHLGMRL-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.781°C at 760 mmHg (Cal.) |
| Flash point | 138.127°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-2,4-Toluenediamine |