|
CAS#: 5070-04-2 Product: 1,5-Bis(guanidino)pentane No suppilers available for the product. |
| Name | 1,5-Bis(guanidino)pentane |
|---|---|
| Synonyms | [N'-[5-[(Amino-Azaniumyl-Methylene)Amino]Pentyl]Carbamimidoyl]Ammonium Dichloride; [Amino-[5-[(Amino-Ammoniomethylene)Amino]Pentylimino]Methyl]Ammonium Dichloride; [N'-[5-[(Amino-Ammonio-Methylene)Amino]Pentyl]Carbamimidoyl]Ammonium Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H20Cl2N6 |
| Molecular Weight | 259.18 |
| CAS Registry Number | 5070-04-2 (58585-48-1) |
| SMILES | C(CCN=C([NH3+])N)CCN=C([NH3+])N.[Cl-].[Cl-] |
| InChI | 1S/C7H18N6.2ClH/c8-6(9)12-4-2-1-3-5-13-7(10)11;;/h1-5H2,(H4,8,9,12)(H4,10,11,13);2*1H |
| InChIKey | DBEFSJBDPOGIOE-UHFFFAOYSA-N |
| Boiling point | 415.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Bis(guanidino)pentane |