|
CAS#: 50746-55-9 Product: 2,6,6-Trimethyl-3-Prop-2-Enyl-Norpinane No suppilers available for the product. |
| Name | 2,6,6-Trimethyl-3-Prop-2-Enyl-Norpinane |
|---|---|
| Synonyms | 3-Allyl-2,6,6-Trimethyl-Norpinane; 3-Allyl-2,6,6-Trimethylnorpinane; 2,7,7-Trimethyl-3-Prop-2-Enyl-Bicyclo[3.1.1]Heptane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 |
| CAS Registry Number | 50746-55-9 |
| SMILES | C(C2C(C1C(C(C1)C2)(C)C)C)C=C |
| InChI | 1S/C13H22/c1-5-6-10-7-11-8-12(9(10)2)13(11,3)4/h5,9-12H,1,6-8H2,2-4H3 |
| InChIKey | IKMZOQZLQUAFMZ-UHFFFAOYSA-N |
| Density | 0.838g/cm3 (Cal.) |
|---|---|
| Boiling point | 211.519°C at 760 mmHg (Cal.) |
| Flash point | 75.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6,6-Trimethyl-3-Prop-2-Enyl-Norpinane |