|
CAS#: 50807-17-5 Product: 2,2-Dichloro-1-[4-(1,1-Dimethylethyl)Phenyl]Ethan-1-One No suppilers available for the product. |
| Name | 2,2-Dichloro-1-[4-(1,1-Dimethylethyl)Phenyl]Ethan-1-One |
|---|---|
| Synonyms | 1-(4-Tert-Butylphenyl)-2,2-Dichloro-Ethanone; 2,2-Dichloro-1-(4-(1,1-Dimethylethyl)Phenyl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 |
| CAS Registry Number | 50807-17-5 |
| EINECS | 256-772-6 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1)C(=O)C(Cl)Cl |
| InChI | 1S/C12H14Cl2O/c1-12(2,3)9-6-4-8(5-7-9)10(15)11(13)14/h4-7,11H,1-3H3 |
| InChIKey | VMCRQYHCDSXNLW-UHFFFAOYSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.607°C at 760 mmHg (Cal.) |
| Flash point | 134.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-1-[4-(1,1-Dimethylethyl)Phenyl]Ethan-1-One |