|
CAS#: 50844-57-0 Product: 3-(1,1,2,2-Tetrafluoroethoxy)Phenyl Isocyanate No suppilers available for the product. |
| Name | 3-(1,1,2,2-Tetrafluoroethoxy)Phenyl Isocyanate |
|---|---|
| Synonyms | M-(1,1,2,2-Tetrafluoroethoxy)Phenyl Isocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5F4NO2 |
| Molecular Weight | 235.14 |
| CAS Registry Number | 50844-57-0 |
| EINECS | 256-795-1 |
| SMILES | O=C=NC1=CC(=CC=C1)OC(F)(F)C(F)F |
| InChI | 1S/C9H5F4NO2/c10-8(11)9(12,13)16-7-3-1-2-6(4-7)14-5-15/h1-4,8H |
| InChIKey | QIGRBWQBVSSVQX-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.556°C at 760 mmHg (Cal.) |
| Flash point | 93.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1,1,2,2-Tetrafluoroethoxy)Phenyl Isocyanate |