|
CAS#: 5090-86-8 Product: Mansonone D No suppilers available for the product. |
| Name | Mansonone D |
|---|---|
| Synonyms | 1,5,8-Trimethyl-1,2-Dihydrobenzo[E]Benzofuran-6,7-Dione; 1,5,8-Trimethyl-1,2-Dihydrobenzo[E]Benzofuran-6,7-Quinone; Mansonone D |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 5090-86-8 |
| SMILES | C1=C3C(=C2C(=C1C)C(=O)C(C(=C2)C)=O)C(CO3)C |
| InChI | 1S/C15H14O3/c1-7-5-11-12(9(3)6-18-11)10-4-8(2)14(16)15(17)13(7)10/h4-5,9H,6H2,1-3H3 |
| InChIKey | LTOSSAVPMIKCBC-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.247°C at 760 mmHg (Cal.) |
| Flash point | 189.38°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mansonone D |