|
CAS#: 50903-48-5 Product: Boc-Alanine Pentafluorophenyl Ester No suppilers available for the product. |
| Name | Boc-Alanine Pentafluorophenyl Ester |
|---|---|
| Synonyms | (2,3,4,5,6-Pentafluorophenyl) (2S)-2-(Tert-Butoxycarbonylamino)Propanoate; (2S)-2-[(Tert-Butoxy-Oxomethyl)Amino]Propanoic Acid (2,3,4,5,6-Pentafluorophenyl) Ester; (2S)-2-(Tert-Butoxycarbonylamino)Propionic Acid (2,3,4,5,6-Pentafluorophenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14F5NO4 |
| Molecular Weight | 355.26 |
| CAS Registry Number | 50903-48-5 |
| SMILES | [C@@H](NC(OC(C)(C)C)=O)(C(OC1=C(F)C(=C(F)C(=C1F)F)F)=O)C |
| InChI | 1S/C14H14F5NO4/c1-5(20-13(22)24-14(2,3)4)12(21)23-11-9(18)7(16)6(15)8(17)10(11)19/h5H,1-4H3,(H,20,22)/t5-/m0/s1 |
| InChIKey | VBVSINJSQBTTDR-YFKPBYRVSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.036°C at 760 mmHg (Cal.) |
| Flash point | 184.245°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Boc-Alanine Pentafluorophenyl Ester |