|
CAS#: 5096-24-2 Product: 2,3-Dihydro-3-Ethyl-6-Methyl-Cyclopenta[a]-Anthracene No suppilers available for the product. |
| Name | 2,3-Dihydro-3-Ethyl-6-Methyl-Cyclopenta[a]-Anthracene |
|---|---|
| Synonyms | 2,3-Dihydro-3-Ethyl-6-Methyl-1H-Cyclopenta(A)Anthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 |
| CAS Registry Number | 5096-24-2 |
| SMILES | C1=C4C(=C3C(=C1)C(=C2C=CC=CC2=C3)C)CCC4CC |
| InChI | 1S/C20H20/c1-3-14-8-9-19-18(14)11-10-17-13(2)16-7-5-4-6-15(16)12-20(17)19/h4-7,10-12,14H,3,8-9H2,1-2H3 |
| InChIKey | LCRYYWPJVUWCSS-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.349°C at 760 mmHg (Cal.) |
| Flash point | 209.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-3-Ethyl-6-Methyl-Cyclopenta[a]-Anthracene |