|
CAS#: 5107-01-7 Product: Alloclamide Hydrochloride No suppilers available for the product. |
| Name | Alloclamide Hydrochloride |
|---|---|
| Synonyms | 2-Allyloxy-4-Chloro-N-(2-Diethylaminoethyl)Benzamide Hydrochloride; 4-Chloro-N-(2-Diethylaminoethyl)-2-Prop-2-Enoxy-Benzamide Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24Cl2N2O2 |
| Molecular Weight | 347.28 |
| CAS Registry Number | 5107-01-7 |
| EINECS | 225-830-2 |
| SMILES | [H+].C1=C(OCC=C)C(=CC=C1Cl)C(=O)NCCN(CC)CC.[Cl-] |
| InChI | 1S/C16H23ClN2O2.ClH/c1-4-11-21-15-12-13(17)7-8-14(15)16(20)18-9-10-19(5-2)6-3;/h4,7-8,12H,1,5-6,9-11H2,2-3H3,(H,18,20);1H |
| InChIKey | QEWLHSNMEXFSCI-UHFFFAOYSA-N |
| Boiling point | 431.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 215°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alloclamide Hydrochloride |