Online Database of Chemicals from Around the World
|
CAS#: 511-36-4 Product: gamma-Chaconine No suppilers available for the product. |
| Name | gamma-Chaconine |
|---|---|
| Synonyms | Gamma-Chaconine |
| Molecular Structure |  |
| Molecular Formula | C33H53NO6 |
| Molecular Weight | 559.78 |
| CAS Registry Number | 511-36-4 |
| SMILES | [C@@H]56[C@@]4([C@H]([C@H]1C([C@@]3(C(=CC1)CC(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO)CC3)C)CC4)C[C@@H]5N7[C@@H]([C@H]6C)CC[C@@H](C7)C)C |
| InChI | 1S/C33H53NO6/c1-17-5-8-24-18(2)27-25(34(24)15-17)14-23-21-7-6-19-13-20(9-11-32(19,3)22(21)10-12-33(23,27)4)39-31-30(38)29(37)28(36)26(16-35)40-31/h6,17-18,20-31,35-38H,5,7-16H2,1-4H3/t17-,18+,20?,21+,22?,23-,24+,25-,26+,27-,28+,29-,30+,31+,32-,33-/m0/s1 |
| InChIKey | IDGKMGZVTKHZDA-QDFBTNNKSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 682.433°C at 760 mmHg (Cal.) |
| Flash point | 366.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Chaconine |