Online Database of Chemicals from Around the World
|
CAS#: 51115-69-6 Product: 2-Isopropyl-N,N,2,3-Tetramethylbutyramide No suppilers available for the product. |
| Name | 2-Isopropyl-N,N,2,3-Tetramethylbutyramide |
|---|---|
| Synonyms | 2-Isopropyl-N,N,2,3-Tetramethyl-Butanamide; 2-Isopropyl-N,N,2,3-Tetramethylbutanamide; 2-Isopropyl-N,N,2,3-Tetramethyl-Butyramide |
| Molecular Structure |  |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 |
| CAS Registry Number | 51115-69-6 |
| EINECS | 256-977-0 |
| SMILES | CN(C(=O)C(C(C)C)(C(C)C)C)C |
| InChI | 1S/C11H23NO/c1-8(2)11(5,9(3)4)10(13)12(6)7/h8-9H,1-7H3 |
| InChIKey | ZYQWAFXFBQUZGE-UHFFFAOYSA-N |
| Density | 0.861g/cm3 (Cal.) |
|---|---|
| Boiling point | 224.318°C at 760 mmHg (Cal.) |
| Flash point | 78.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-N,N,2,3-Tetramethylbutyramide |