|
CAS#: 51170-87-7 Product: N-(2,4-Dichlorophenyl)-4,5-Dihydro-3H-Pyrrol-2-Amine No suppilers available for the product. |
| Name | N-(2,4-Dichlorophenyl)-4,5-Dihydro-3H-Pyrrol-2-Amine |
|---|---|
| Synonyms | (2,4-Dichlorophenyl)-(1-Pyrrolin-2-Yl)Amine; Brn 0393650; 2H-Pyrrol-5-Amine, 3,4-Dihydro-N-(2,4-Dichlorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 |
| CAS Registry Number | 51170-87-7 |
| SMILES | C1=C(C(=CC=C1Cl)NC2=NCCC2)Cl |
| InChI | 1S/C10H10Cl2N2/c11-7-3-4-9(8(12)6-7)14-10-2-1-5-13-10/h3-4,6H,1-2,5H2,(H,13,14) |
| InChIKey | HMFNCVBHZDSLKZ-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.432°C at 760 mmHg (Cal.) |
| Flash point | 174.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dichlorophenyl)-4,5-Dihydro-3H-Pyrrol-2-Amine |