|
CAS#: 51171-84-7 Product: (E)-4-Amino-1-Phenyl-Cyclohexanol alpha-Ethyl-4-Biphenylacetate No suppilers available for the product. |
| Name | (E)-4-Amino-1-Phenyl-Cyclohexanol alpha-Ethyl-4-Biphenylacetate |
|---|---|
| Synonyms | 4-Amino-1-Phenyl-Cyclohexan-1-Ol; 2-(4-Phenylphenyl)Butanoic Acid; 4-Amino-1-Phenyl-1-Cyclohexanol; 2-(4-Phenylphenyl)Butanoic Acid; 4-Amino-1-Phenyl-Cyclohexan-1-Ol; 2-(4-Phenylphenyl)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.57 |
| CAS Registry Number | 51171-84-7 (51171-85-8) |
| SMILES | C2=C(C1(O)CCC(N)CC1)C=CC=C2.C3=C(C(CC)C(O)=O)C=CC(=C3)C4=CC=CC=C4 |
| InChI | 1S/C16H16O2.C12H17NO/c1-2-15(16(17)18)14-10-8-13(9-11-14)12-6-4-3-5-7-12;13-11-6-8-12(14,9-7-11)10-4-2-1-3-5-10/h3-11,15H,2H2,1H3,(H,17,18);1-5,11,14H,6-9,13H2 |
| InChIKey | ZWRDPQHFNWIGJW-UHFFFAOYSA-N |
| Boiling point | 400.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 296.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4-Amino-1-Phenyl-Cyclohexanol alpha-Ethyl-4-Biphenylacetate |