| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Butedronic Acid |
|---|---|
| Synonyms | 2-(Diphosphonomethyl)Succinic Acid; (Diphosphonomethyl)Succinic Acid.; Butedronic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O10P2 |
| Molecular Weight | 292.08 |
| CAS Registry Number | 51395-42-7 |
| SMILES | C(C(C([P](O)(=O)O)[P](O)(=O)O)C(=O)O)C(=O)O |
| InChI | 1S/C5H10O10P2/c6-3(7)1-2(4(8)9)5(16(10,11)12)17(13,14)15/h2,5H,1H2,(H,6,7)(H,8,9)(H2,10,11,12)(H2,13,14,15) |
| InChIKey | LDTZSTJLVYBEKB-UHFFFAOYSA-N |
| Density | 2.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 701.4±70.0°C at 760 mmHg (Cal.) |
| Flash point | 378.0±35.7°C (Cal.) |
| (1) | Wenxiao Pan, Bruce Caswell and George Em Karniadakis. A low-dimensional model for the red blood cell, Soft Matter, 2010, 6, 4366. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Butedronic Acid |