| Name | D-Glucose, mixt. with 2-hydroxy-1,2,3-propanetricarboxylic acid and phosphoric acid |
|---|---|
| Synonyms | Citric Acid; (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanal; Phosphoric Acid; 0.5 Citrate Cpd; Citroglucophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23O17P |
| Molecular Weight | 470.28 |
| CAS Registry Number | 51404-37-6 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)CO)[C@@H](O)C=O.O=[P](O)(O)O.C(C(O)(C(=O)O)CC(=O)O)C(=O)O |
| InChI | 1S/C6H8O7.C6H12O6.H3O4P/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-1-3(9)5(11)6(12)4(10)2-8;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1,3-6,8-12H,2H2;(H3,1,2,3,4)/t;3-,4+,5+,6+;/m.0./s1 |
| InChIKey | RSGFPIWWSCWCFJ-VAXZQHAWSA-N |
| Boiling point | 309.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Glucose, mixt. with 2-hydroxy-1,2,3-propanetricarboxylic acid and phosphoric acid |