Online Database of Chemicals from Around the World
| Shanghai Heat-biochem Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 18192275873 | |||
 |
sales@heat-biochem.com | |||
 |
QQ Chat | |||
| Chemical distributor since 2014 | ||||
| chemBlink massive supplier since 2017 | ||||
| Name | Bis(2-Naphthoyl)Methane |
|---|---|
| Synonyms | 1,3-Bis(2-Naphthyl)Propane-1,3-Dione; 1,3-Propanedione, 1,3-Di-2-Naphthalenyl- |
| Molecular Structure |  |
| Molecular Formula | C23H16O2 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 51583-97-2 |
| SMILES | C3=C(C(CC(C2=CC1=CC=CC=C1C=C2)=O)=O)C=CC4=CC=CC=C34 |
| InChI | 1S/C23H16O2/c24-22(20-11-9-16-5-1-3-7-18(16)13-20)15-23(25)21-12-10-17-6-2-4-8-19(17)14-21/h1-14H,15H2 |
| InChIKey | BSYFDFPTOXRGMP-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.558°C at 760 mmHg (Cal.) |
| Flash point | 206.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Naphthoyl)Methane |