Online Database of Chemicals from Around the World
|
CAS#: 51787-79-2 Product: 1,1'-(4-Iodobutylidene)Bis[4-Fluorobenzene] No suppilers available for the product. |
| Name | 1,1'-(4-Iodobutylidene)Bis[4-Fluorobenzene] |
|---|---|
| Synonyms | 1-Fluoro-4-[1-(4-Fluorophenyl)-4-Iodo-Butyl]Benzene; 1,1'-(4-Iodobutylidene)Bis(4-Fluorobenzene) |
| Molecular Structure | ![CAS#: 51787-79-2, 1,1'-(4-Iodobutylidene)Bis[4-Fluorobenzene]](/moreStructures/51787-79-2.gif) |
| Molecular Formula | C16H15F2I |
| Molecular Weight | 372.20 |
| CAS Registry Number | 51787-79-2 |
| EINECS | 257-419-9 |
| SMILES | C2=C(C(C1=CC=C(C=C1)F)CCCI)C=CC(=C2)F |
| InChI | 1S/C16H15F2I/c17-14-7-3-12(4-8-14)16(2-1-11-19)13-5-9-15(18)10-6-13/h3-10,16H,1-2,11H2 |
| InChIKey | OZMORHVDUHRQLL-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.468°C at 760 mmHg (Cal.) |
| Flash point | 169.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(4-Iodobutylidene)Bis[4-Fluorobenzene] |