| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> FMOC-amino acid |
|---|---|
| Name | (3R)-3-(2-Bromophenyl)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}Propanoic Acid |
| Synonyms | (R)-3-((( |
| Molecular Structure | ![]() |
| Molecular Formula | C24H20BrNO4 |
| Molecular Weight | 466.32 |
| CAS Registry Number | 517905-84-9 |
| SMILES | Brc1ccccc1[C@H](NC(=O)OCC4c2ccccc2c3c4cccc3)CC(=O)O |
| InChI | 1S/C24H20BrNO4/c25-21-12-6-5-11-19(21)22(13-23(27)28)26-24(29)30-14-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1 |
| InChIKey | DXTFQBWZFOPYGV-JOCHJYFZSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 656.552°C at 760 mmHg (Cal.) |
| Flash point | 350.87°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3R)-3-(2-Bromophenyl)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}Propanoic Acid |