|
CAS#: 5185-71-7 Product: 4-[N,N-Bis(2-Chloroethyl)Amino]Phenylarsonic Acid No suppilers available for the product. |
| Name | 4-[N,N-Bis(2-Chloroethyl)Amino]Phenylarsonic Acid |
|---|---|
| Synonyms | Brn 2852551; N,N-Bis(2-Chloroethyl)-P-Arsanilic Acid; P-Arsanilic Acid, N,N-Bis(2-Chloroethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14AsCl2NO3 |
| Molecular Weight | 342.05 |
| CAS Registry Number | 5185-71-7 |
| SMILES | C1=CC(=CC=C1N(CCCl)CCCl)[As](O)(O)=O |
| InChI | 1S/C10H14AsCl2NO3/c12-5-7-14(8-6-13)10-3-1-9(2-4-10)11(15,16)17/h1-4H,5-8H2,(H2,15,16,17) |
| InChIKey | RXMOZLCWMOBJCM-UHFFFAOYSA-N |
| Boiling point | 556.854°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 290.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[N,N-Bis(2-Chloroethyl)Amino]Phenylarsonic Acid |