|
CAS#: 519-21-1 Product: Mycaminose No suppilers available for the product. |
| Name | Mycaminose |
|---|---|
| Synonyms | (2R,3S,4S,5R)-3-Dimethylamino-2,4,5-Trihydroxy-Hexanal; 3,6-Dideoxy-3-(Dimethylamino)-D-Glucose; 3,6-Dideoxy-3-Dimethylamino-D-Glucose |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 519-21-1 |
| SMILES | [C@H]([C@@H]([C@H](O)C)O)([C@H](C=O)O)N(C)C |
| InChI | 1S/C8H17NO4/c1-5(11)8(13)7(9(2)3)6(12)4-10/h4-8,11-13H,1-3H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | IJUPCLYLISRDRA-ULAWRXDQSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.411°C at 760 mmHg (Cal.) |
| Flash point | 132.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mycaminose |