|
CAS#: 519-67-5 Product: 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)-2,5-Cyclohexadiene-1,4-Dione No suppilers available for the product. |
| Name | 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)-2,5-Cyclohexadiene-1,4-Dione |
|---|---|
| Synonyms | 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)-1,4-Benzoquinone; 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)-P-Benzoquinone; 2,5-Cyclohexadiene-1,4-Dione, 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 |
| CAS Registry Number | 519-67-5 |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C(=C(C2=O)O)C3=CC=C(C=C3)O)O)O |
| InChI | 1S/C18H12O6/c19-11-5-1-9(2-6-11)13-15(21)17(23)14(18(24)16(13)22)10-3-7-12(20)8-4-10/h1-8,19-21,24H |
| InChIKey | FKQQKMGWCJGUCS-UHFFFAOYSA-N |
| Density | 1.644g/cm3 (Cal.) |
|---|---|
| Boiling point | 651.328°C at 760 mmHg (Cal.) |
| Flash point | 361.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dihydroxy-3,6-Bis(4-Hydroxyphenyl)-2,5-Cyclohexadiene-1,4-Dione |