|
CAS#: 519057-99-9 Product: (1S,1'R,4'S)-4'-Ethyl-4-[4-(Trifluoromethoxy)Phenyl]-1,1'-Bi(Cyclohexan)-3-Ene No suppilers available for the product. |
| Name | (1S,1'R,4'S)-4'-Ethyl-4-[4-(Trifluoromethoxy)Phenyl]-1,1'-Bi(Cyclohexan)-3-Ene |
|---|---|
| Synonyms | Benzene, |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27F3O |
| Molecular Weight | 352.43 |
| CAS Registry Number | 519057-99-9 |
| SMILES | CC[C@H]1CC[C@@H](CC1)C2CC=C(CC2)c3ccc(cc3)OC(F)(F)F |
| InChI | 1S/C21H27F3O/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)19-11-13-20(14-12-19)25-21(22,23)24/h9,11-17H,2-8,10H2,1H3/t15-,16-,17? |
| InChIKey | PZSCPOQUYAZWQV-BDWYFLKXSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.071°C at 760 mmHg (Cal.) |
| Flash point | 195.908°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,1'R,4'S)-4'-Ethyl-4-[4-(Trifluoromethoxy)Phenyl]-1,1'-Bi(Cyclohexan)-3-Ene |