|
CAS#: 52101-40-3 Product: 3,4-Diphenyl-5-Nitro-2-Furoic acid No suppilers available for the product. |
| Name | 3,4-Diphenyl-5-Nitro-2-Furoic acid |
|---|---|
| Synonyms | 5-Nitro-3,4-Di(Phenyl)-2-Furancarboxylic Acid; 5-Nitro-3,4-Di(Phenyl)-2-Furoic Acid; Ccris 2154 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H11NO5 |
| Molecular Weight | 309.28 |
| CAS Registry Number | 52101-40-3 |
| SMILES | C3=C(C1=C(OC(=C1C2=CC=CC=C2)C(=O)O)[N+]([O-])=O)C=CC=C3 |
| InChI | 1S/C17H11NO5/c19-17(20)15-13(11-7-3-1-4-8-11)14(16(23-15)18(21)22)12-9-5-2-6-10-12/h1-10H,(H,19,20) |
| InChIKey | HZKQRIMQLFWOGN-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.839°C at 760 mmHg (Cal.) |
| Flash point | 216.179°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenyl-5-Nitro-2-Furoic acid |