|
CAS#: 521087-49-0 Product: (3S)-3-Nitro-2-Butanone No suppilers available for the product. |
| Name | (3S)-3-Nitro-2-Butanone |
|---|---|
| Synonyms | 2-Butanone, 3-nitro-, (3S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 |
| CAS Registry Number | 521087-49-0 |
| SMILES | C[C@@H](C(=O)C)[N+](=O)[O-] |
| InChI | 1S/C4H7NO3/c1-3(4(2)6)5(7)8/h3H,1-2H3/t3-/m0/s1 |
| InChIKey | UBAAKWLZKDBMLA-VKHMYHEASA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 172.226°C at 760 mmHg (Cal.) |
| Flash point | 64.987°C (Cal.) |
| Refractive index | 1.421 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S)-3-Nitro-2-Butanone |