|
CAS#: 52166-72-0 Product: Sodium 2,5-Dichlorophenolate No suppilers available for the product. |
| Name | Sodium 2,5-Dichlorophenolate |
|---|---|
| Synonyms | Phenol, 2,5-Dichloro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3Cl2NaO |
| Molecular Weight | 184.98 |
| CAS Registry Number | 52166-72-0 |
| EINECS | 257-697-1 |
| SMILES | C1=C(C=CC(=C1[O-])Cl)Cl.[Na+] |
| InChI | 1S/C6H4Cl2O.Na/c7-4-1-2-5(8)6(9)3-4;/h1-3,9H;/q;+1/p-1 |
| InChIKey | YLJQSXXOUNWETA-UHFFFAOYSA-M |
| Boiling point | 214.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,5-Dichlorophenolate |