Online Database of Chemicals from Around the World
|
CAS#: 52176-20-2 Product: 1,1'-[Methylenebis(Oxy)]Bis[2,4,6-Tribromobenzene] No suppilers available for the product. |
| Name | 1,1'-[Methylenebis(Oxy)]Bis[2,4,6-Tribromobenzene] |
|---|---|
| Synonyms | 1,1'-(Methylenebis(Oxy))Bis(2,4,6-Tribromobenzene) |
| Molecular Structure | ![CAS#: 52176-20-2, 1,1'-[Methylenebis(Oxy)]Bis[2,4,6-Tribromobenzene]](/moreStructures/52176-20-2.gif) |
| Molecular Formula | C13H6Br6O2 |
| Molecular Weight | 673.61 |
| CAS Registry Number | 52176-20-2 |
| EINECS | 257-704-8 |
| SMILES | C1=C(C=C(C(=C1Br)OCOC2=C(C=C(C=C2Br)Br)Br)Br)Br |
| InChI | 1S/C13H6Br6O2/c14-6-1-8(16)12(9(17)2-6)20-5-21-13-10(18)3-7(15)4-11(13)19/h1-4H,5H2 |
| InChIKey | FNXLWHARVDGLKF-UHFFFAOYSA-N |
| Density | 2.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.176°C at 760 mmHg (Cal.) |
| Flash point | 236.005°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[Methylenebis(Oxy)]Bis[2,4,6-Tribromobenzene] |