|
CAS#: 52212-80-3 Product: 1-(Acetyloxy)-1H-Purin-6-Amine No suppilers available for the product. |
| Name | 1-(Acetyloxy)-1H-Purin-6-Amine |
|---|---|
| Synonyms | Acetic Acid (6-Amino-1-Purinyl) Ester; Acetic Acid (6-Aminopurin-1-Yl) Ester; (6-Aminopurin-1-Yl) Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.16 |
| CAS Registry Number | 52212-80-3 |
| SMILES | CC(O[N]2C=NC1=NC=NC1=C2N)=O |
| InChI | 1S/C7H7N5O2/c1-4(13)14-12-3-11-7-5(6(12)8)9-2-10-7/h2-3H,8H2,1H3 |
| InChIKey | OZNAPFDKLDQWLO-UHFFFAOYSA-N |
| Density | 1.711g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.317°C at 760 mmHg (Cal.) |
| Flash point | 131.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Acetyloxy)-1H-Purin-6-Amine |