|
CAS#: 52321-65-0 Product: alpha-Methyl-2-Phenyl-5-Benzothiazoleacetic Acid No suppilers available for the product. |
| Name | alpha-Methyl-2-Phenyl-5-Benzothiazoleacetic Acid |
|---|---|
| Synonyms | 2-(2-Phenyl-1,3-Benzothiazol-5-Yl)Propionic Acid; 5-Benzothiazoleacetic Acid, .Alpha.-Methyl-2-Phenyl-; Nsc302076 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.34 |
| CAS Registry Number | 52321-65-0 |
| SMILES | C1=C(C=CC2=C1N=C(S2)C3=CC=CC=C3)C(C(O)=O)C |
| InChI | 1S/C16H13NO2S/c1-10(16(18)19)12-7-8-14-13(9-12)17-15(20-14)11-5-3-2-4-6-11/h2-10H,1H3,(H,18,19) |
| InChIKey | XCGOOGLJHMKVRE-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.973°C at 760 mmHg (Cal.) |
| Flash point | 243.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-2-Phenyl-5-Benzothiazoleacetic Acid |