|
CAS#: 52322-80-2 Product: 1,2,4-Trichloro-5-Phenoxybenzene No suppilers available for the product. |
| Name | 1,2,4-Trichloro-5-Phenoxybenzene |
|---|---|
| Synonyms | 2,4,5-Trichlorodiphenyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.55 |
| CAS Registry Number | 52322-80-2 |
| SMILES | C1=C(Cl)C(=CC(=C1Cl)Cl)OC2=CC=CC=C2 |
| InChI | 1S/C12H7Cl3O/c13-9-6-11(15)12(7-10(9)14)16-8-4-2-1-3-5-8/h1-7H |
| InChIKey | UWKZWXCTDPYXHU-UHFFFAOYSA-N |
| Density | 1.397g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.278°C at 760 mmHg (Cal.) |
| Flash point | 119.483°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Trichloro-5-Phenoxybenzene |