|
CAS#: 52348-51-3 Product: 2,6-Diisobutylphenol No suppilers available for the product. |
| Name | 2,6-Diisobutylphenol |
|---|---|
| Synonyms | 2,6-Diisobutylphenol; Phenol, 2,6-Bis(2-Methylpropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 52348-51-3 |
| EINECS | 257-865-4 |
| SMILES | C1=C(C(=C(C=C1)CC(C)C)O)CC(C)C |
| InChI | 1S/C14H22O/c1-10(2)8-12-6-5-7-13(14(12)15)9-11(3)4/h5-7,10-11,15H,8-9H2,1-4H3 |
| InChIKey | JRPBSTGRRSTANR-UHFFFAOYSA-N |
| Density | 0.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.641°C at 760 mmHg (Cal.) |
| Flash point | 132.873°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diisobutylphenol |