Online Database of Chemicals from Around the World
|
CAS#: 52373-83-8 Product: Aflatoxin D1 No suppilers available for the product. |
| Name | Aflatoxin D1 |
|---|---|
| Synonyms | 3-[(3Ar,8Bs)-8-Hydroxy-6-Methoxy-3A,8B-Dihydrofuro[2,3-B]Benzofuran-7-Yl]Cyclopent-2-En-1-One; 3-[(3Ar,8Bs)-8-Hydroxy-6-Methoxy-3A,8B-Dihydrofuro[2,3-B]Benzofuran-7-Yl]-1-Cyclopent-2-Enone; 2-Cyclopenten-1-One, 3-((3As,8Ar)-3A,8A-Dihydro-4-Hydroxy-6-Methoxyfuro(2,3-B)Benzofuran-5-Yl)- |
| Molecular Structure |  |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 |
| CAS Registry Number | 52373-83-8 |
| SMILES | [C@@H]23OC1=CC(=C(C(=C1[C@@H]2C=CO3)O)C4=CC(CC4)=O)OC |
| InChI | 1S/C16H14O5/c1-19-11-7-12-14(10-4-5-20-16(10)21-12)15(18)13(11)8-2-3-9(17)6-8/h4-7,10,16,18H,2-3H2,1H3/t10-,16+/m0/s1 |
| InChIKey | JRUMBKYTDKXCJC-MGPLVRAMSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.752°C at 760 mmHg (Cal.) |
| Flash point | 143.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aflatoxin D1 |