|
CAS#: 52470-38-9 Product: Manganesemaleate No suppilers available for the product. |
| Name | Manganesemaleate |
|---|---|
| Synonyms | Manganous (Z)-4-Hydroxy-4-Oxo-But-2-Enoate; Manganous (Z)-4-Hydroxy-4-Oxobut-2-Enoate; Manganous (Z)-4-Hydroxy-4-Keto-But-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6MnO8 |
| Molecular Weight | 285.07 |
| CAS Registry Number | 52470-38-9 |
| SMILES | O=C([O-])\C=C/C(=O)O.O=C([O-])\C=C/C(=O)O.[Mn++] |
| InChI | 1S/2C4H4O4.Mn/c2*5-3(6)1-2-4(7)8;/h2*1-2H,(H,5,6)(H,7,8);/q;;+2/p-2/b2*2-1-; |
| InChIKey | QTAPRNXNAHBUTR-PAMPIZDHSA-L |
| Boiling point | 355.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganesemaleate |