|
CAS#: 52483-05-3 Product: Lactarorufin B No suppilers available for the product. |
| Name | Lactarorufin B |
|---|---|
| Synonyms | 5,9-Dihydroxy-5,7-Dimethyl-7-Methylol-4,5A,6,8,8A,9-Hexahydro-1H-Azuleno[6,5-C]Furan-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 52483-05-3 |
| SMILES | C(C3(CC2C(C1=C(C(=O)OC1)CC(O)(C)C2C3)O)C)O |
| InChI | 1S/C15H22O5/c1-14(7-16)3-9-11(5-14)15(2,19)4-8-10(12(9)17)6-20-13(8)18/h9,11-12,16-17,19H,3-7H2,1-2H3 |
| InChIKey | DBKIEMOKQWYZOA-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.73°C at 760 mmHg (Cal.) |
| Flash point | 201.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lactarorufin B |