|
CAS#: 52497-66-2 Product: Nitrochlorphentermine No suppilers available for the product. |
| Name | Nitrochlorphentermine |
|---|---|
| Synonyms | 1-Chloro-4-(2-Methyl-2-Nitro-Propyl)Benzene; Benzene, 1-Chloro-4-(2-Methyl-2-Nitropropyl)-; Nitrochlorphentermine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 52497-66-2 |
| SMILES | C1=C(CC([N+]([O-])=O)(C)C)C=CC(=C1)Cl |
| InChI | 1S/C10H12ClNO2/c1-10(2,12(13)14)7-8-3-5-9(11)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | YLORHEQBPSTIOL-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.851°C at 760 mmHg (Cal.) |
| Flash point | 140.589°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrochlorphentermine |