|
CAS#: 5271-39-6 Product: 1,1,1-Triphenylethane No suppilers available for the product. |
| Name | 1,1,1-Triphenylethane |
|---|---|
| Synonyms | Ai3-09183; Ai3-19833; Benzene, 1,1',1''-Ethanetriyltris- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 |
| CAS Registry Number | 5271-39-6 |
| SMILES | C1=CC=CC=C1C(C2=CC=CC=C2)(C3=CC=CC=C3)C |
| InChI | 1S/C20H18/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | QIDUHGHFWAMMPV-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.707°C at 760 mmHg (Cal.) |
| Flash point | 169.163°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Triphenylethane |