|
CAS#: 52718-49-7 Product: Ethyl 3,7,12-Trioxo-5beta-cholan-24-Oate No suppilers available for the product. |
| Name | Ethyl 3,7,12-Trioxo-5beta-cholan-24-Oate |
|---|---|
| Synonyms | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-Dimethyl-3,7,12-Trioxo-1,2,4,5,6,8,9,11,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-17-Yl]Pentanoic Acid Ethyl Ester; (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-3,7,12-Triketo-10,13-Dimethyl-1,2,4,5,6,8,9,11,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-17-Yl]Valeric Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.58 |
| CAS Registry Number | 52718-49-7 |
| EINECS | 258-126-9 |
| SMILES | [C@]34([C@H]([C@H]1[C@@H]([C@@]2([C@H](CC1=O)CC(=O)CC2)C)CC3=O)CC[C@@H]4[C@@H](CCC(=O)OCC)C)C |
| InChI | 1S/C26H38O5/c1-5-31-23(30)9-6-15(2)18-7-8-19-24-20(14-22(29)26(18,19)4)25(3)11-10-17(27)12-16(25)13-21(24)28/h15-16,18-20,24H,5-14H2,1-4H3/t15-,16+,18-,19+,20+,24+,25+,26-/m1/s1 |
| InChIKey | JOLKBUSRBZYZEH-PYGYYAGESA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.817°C at 760 mmHg (Cal.) |
| Flash point | 233.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3,7,12-Trioxo-5beta-cholan-24-Oate |