|
CAS#: 5284-07-1 Product: Dimethyl-Phosphinic Acid 1,4-Butanediyl Ester No suppilers available for the product. |
| Name | Dimethyl-Phosphinic Acid 1,4-Butanediyl Ester |
|---|---|
| Synonyms | (4-Dimethylphosphoryloxybutoxy-Methyl-Phosphoryl)Methane; Nsc81556; 1,4-Butanediol, Bis(Dimethylphosphinate) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H20O4P2 |
| Molecular Weight | 242.19 |
| CAS Registry Number | 5284-07-1 |
| SMILES | C(O[P](C)(=O)C)CCCO[P](C)(=O)C |
| InChI | 1S/C8H20O4P2/c1-13(2,9)11-7-5-6-8-12-14(3,4)10/h5-8H2,1-4H3 |
| InChIKey | NPJUOKHNGXTQIQ-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.149°C at 760 mmHg (Cal.) |
| Flash point | 158.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-Phosphinic Acid 1,4-Butanediyl Ester |