|
CAS#: 529-92-0 Product: Cusparine No suppilers available for the product. |
| Name | Cusparine |
|---|---|
| Synonyms | 2-[2-(1,3-Benzodioxol-5-Yl)Ethyl]-4-Methoxy-Quinoline; C10655; Cusparine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 |
| CAS Registry Number | 529-92-0 |
| SMILES | C1=C(N=C2C(=C1OC)C=CC=C2)CCC3=CC=C4C(=C3)OCO4 |
| InChI | 1S/C19H17NO3/c1-21-18-11-14(20-16-5-3-2-4-15(16)18)8-6-13-7-9-17-19(10-13)23-12-22-17/h2-5,7,9-11H,6,8,12H2,1H3 |
| InChIKey | RIXOVHWIYRZQDC-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.292°C at 760 mmHg (Cal.) |
| Flash point | 151.462°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cusparine |